| product Name | N-Carbobenzyloxy-DL-serine | | Synonyms | N-cbz-dl-serine crystalline; carbobenzyloxy-dl-serine; Z-dl-serine; N-benzyloxycarbonyl-DL-serine; Z-DL-Ser-OH; N-((benzyloxy)carbonyl)serine; N-CBZ-DL-Serine N-Carbobenzyloxy-DL-serine; Carbobenzoxyserine; N-CBZ-DL-Serine; N-Carbobenzoxy-DL-serine; (2S)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxypropanoate; (2R)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxypropanoate; Cbz-DL-serine | | Molecular Formula | C11H12NO5 | | Molecular Weight | 238.2172 | | InChI | InChI=1/C11H13NO5/c13-6-9(10(14)15)12-11(16)17-7-8-4-2-1-3-5-8/h1-5,9,13H,6-7H2,(H,12,16)(H,14,15)/p-1/t9-/m1/s1 | | CAS Registry Number | 2768-56-1 | | EINECS | 220-455-0 | | Molecular Structure | | | Melting point | 122-126℃ | | Boiling point | 487.5°C at 760 mmHg | | Flash point | 248.6°C | | Vapour Pressur | 2.56E-10mmHg at 25°C | | Hazard Symbols | | | Risk Codes | | | Safety Description | S24/25:Avoid contact with skin and eyes.; | |